Products 2692623-88-2
CAS 2692623-88-2 appears in our catalog under these names: 7(Z),10(Z),13(Z)–Hexadecatrienoic Acid–d6, (7Z,10Z,13Z)-7,10,13-Hexadecatrienoic-7,8,10,11,13,14-d6 acid. Offered by: GLPBio, MedChemExpress. Available pack sizes: 2mg, Get quote.
(7E,10E,13E)-7,8,10,11,13,14-hexadeuteriohexadeca-7,10,13-trienoic acid (CAS 2692623-88-2) is a chemical compound with the molecular formula C16H26O2 and a molecular weight of 256.41 g/mol. IUPAC name: (7E,10E,13E)-7,8,10,11,13,14-hexadeuteriohexadeca-7,10,13-trienoic acid. InChIKey: KBGYPXOSNDMZRV-KNQOWOOHSA-N.
| Molecular formula | C16H26O2 |
|---|---|
| Molecular weight | 256.41 g/mol |
| IUPAC name | (7E,10E,13E)-7,8,10,11,13,14-hexadeuteriohexadeca-7,10,13-trienoic acid |
| InChIKey | KBGYPXOSNDMZRV-KNQOWOOHSA-N |
| SMILES | [2H]/C(=C(/[2H])\C/C(=C(\[2H])/C/C(=C(\[2H])/CCCCCC(=O)O)/[2H])/[2H])/CC |
Computed by PubChem (NCBI)