CAS 26927-44-6 appears in our catalog under these names: 2,6-Di-O-benzoyl-methyl-a-D-glucopyranoside, 98%, 2,6-Di-O-benzoyl-methyl-a-D-glucopyranoside. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 10g.
[(2R,3S,4S,5R,6S)-5-benzoyloxy-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl benzoate (CAS 26927-44-6) is a chemical compound with the molecular formula C21H22O8 and a molecular weight of 402.4 g/mol. IUPAC name: [(2R,3S,4S,5R,6S)-5-benzoyloxy-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl benzoate. InChIKey: XILYXPMGDAVPPF-YKGACUOXSA-N.
| Molecular formula | C21H22O8 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6S)-5-benzoyloxy-3,4-dihydroxy-6-methoxyoxan-2-yl]methyl benzoate |
| InChIKey | XILYXPMGDAVPPF-YKGACUOXSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C2=CC=CC=C2)O)O)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)