CAS 34170-18-8 appears in our catalog under these names: 3,5,6,7,8,4'-Hexamethoxyflavone, ≥98%, ≥98%, 3,5,6,7,8,4'-Hexamethoxyflavone, 99.98%. Offered by: Chemat, MedChemExpress. Available pack sizes: 20mg, 1 mg, 5 mg.
3,5,6,7,8-pentamethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 34170-18-8) is a chemical compound with the molecular formula C21H22O8 and a molecular weight of 402.4 g/mol. IUPAC name: 3,5,6,7,8-pentamethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: OBIOZWXPDBWYHB-UHFFFAOYSA-N.
| Molecular formula | C21H22O8 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 3,5,6,7,8-pentamethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | OBIOZWXPDBWYHB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C(=C(C(=C3OC)OC)OC)OC)OC |
Computed by PubChem (NCBI)