CAS 29043-07-0 appears in our catalog under these names: 3',4',5',5,6,7-Hexamethoxyflavone, 95%, 3',4',5',5,6,7-Hexamethoxyflavone, 5,6,7-Trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one, 99.80% ,, 99.80% ,, 3′,4′,5′,5,6,7-Hexamethoxyflavone, 99.06%, 3',4',5',5,6,7-Hexamethoxyflavone, min. 95 %, 10 mg. Offered by: Combi-blocks, Biosynth, Chemat, MedChemExpress, Roth. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 1mg, 5mg, 25 mg, 5 mg.
5,6,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (CAS 29043-07-0) is a chemical compound with the molecular formula C21H22O8 and a molecular weight of 402.4 g/mol. IUPAC name: 5,6,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one. InChIKey: DYDFNKUHYXHWFM-UHFFFAOYSA-N.
| Molecular formula | C21H22O8 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 5,6,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| InChIKey | DYDFNKUHYXHWFM-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=CC(=O)C3=C(C(=C(C=C3O2)OC)OC)OC |
Computed by PubChem (NCBI)