CAS 269398-83-6 appears in our catalog under these names: Boc-(r)-3-amino-4-(3-methyl-phenyl)-butyric acid, 95%, Boc–3–methyl–D–beta–homophenylalanine, (R)-3-((tert-Butoxycarbonyl)amino)-4-(m-tolyl)butanoic acid, 97%, 97%, Boc-3-methyl-D-b-homophenylalanine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
(3R)-4-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 269398-83-6) is a chemical compound with the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. IUPAC name: (3R)-4-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: JTZSMOJWZPUZGN-CYBMUJFWSA-N.
| Molecular formula | C16H23NO4 |
|---|---|
| Molecular weight | 293.36 g/mol |
| IUPAC name | (3R)-4-(3-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | JTZSMOJWZPUZGN-CYBMUJFWSA-N |
| SMILES | CC1=CC(=CC=C1)C[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)