CAS 269398-88-1 appears in our catalog under these names: (R)-3-Amino-4-(1-naphthyl)butanoic acid hydrochloride, 98%, (R)-3-Amino-4-(naphthalen-1-yl)butanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
(3R)-3-amino-4-naphthalen-1-ylbutanoic acid;hydrochloride (CAS 269398-88-1) is a chemical compound with the molecular formula C14H16ClNO2 and a molecular weight of 265.73 g/mol. IUPAC name: (3R)-3-amino-4-naphthalen-1-ylbutanoic acid;hydrochloride. InChIKey: AZXBBARHJITLTI-UTONKHPSSA-N.
| Molecular formula | C14H16ClNO2 |
|---|---|
| Molecular weight | 265.73 g/mol |
| IUPAC name | (3R)-3-amino-4-naphthalen-1-ylbutanoic acid;hydrochloride |
| InChIKey | AZXBBARHJITLTI-UTONKHPSSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)