CAS 331846-99-2 appears in our catalog under these names: (S)-3-Amino-4-(1-naphthyl)butanoic acid hydrochloride, 98%, (S)-3-Amino-4-(1-naphthyl)butanoic acid hydrochloride, (S)-3-Amino-4-(1-naphthyl)butanoic acid hydrochloride, 98%, 98%. Offered by: Combi-blocks, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg, 1000mg, 2000mg.
(3S)-3-amino-4-naphthalen-1-ylbutanoic acid;hydrochloride (CAS 331846-99-2) is a chemical compound with the molecular formula C14H16ClNO2 and a molecular weight of 265.73 g/mol. IUPAC name: (3S)-3-amino-4-naphthalen-1-ylbutanoic acid;hydrochloride. InChIKey: AZXBBARHJITLTI-YDALLXLXSA-N.
| Molecular formula | C14H16ClNO2 |
|---|---|
| Molecular weight | 265.73 g/mol |
| IUPAC name | (3S)-3-amino-4-naphthalen-1-ylbutanoic acid;hydrochloride |
| InChIKey | AZXBBARHJITLTI-YDALLXLXSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)