CAS 63024-26-0 appears in our catalog under these names: H-Ala(2-naphthyl)-OMe hydrochloride, 97%, (S)–Methyl 2–amino–3–(naphthalen–2–yl)propanoate hydrochloride, L-4-Chlorophenylalanine methyl ester hydrochloride, (S)-Methyl 2-amino-3-(naphthalen-2-yl)propanoate hydrochloride, 97%, 97%, L-2-Naphthylalanine methyl ester hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 100mg, 250mg, 2.5g, 10g.
Methyl (2S)-2-amino-3-naphthalen-2-ylpropanoate;hydrochloride (CAS 63024-26-0) is a chemical compound with the molecular formula C14H16ClNO2 and a molecular weight of 265.73 g/mol. IUPAC name: methyl (2S)-2-amino-3-naphthalen-2-ylpropanoate;hydrochloride. InChIKey: BYTYONAXVAIPOV-ZOWNYOTGSA-N.
| Molecular formula | C14H16ClNO2 |
|---|---|
| Molecular weight | 265.73 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-naphthalen-2-ylpropanoate;hydrochloride |
| InChIKey | BYTYONAXVAIPOV-ZOWNYOTGSA-N |
| SMILES | COC(=O)[C@H](CC1=CC2=CC=CC=C2C=C1)N.Cl |
Computed by PubChem (NCBI)