Products 2696257-39-1
CAS 2696257-39-1 is the registry number for rel-Methyl (3aS,6aR)-5-benzylhexahydro-3aH-furo[2,3-c]pyrrole-3a-carboxylate, 97%. Offered by: Ambeed, BLDpharm. Available pack sizes: 1g, 250mg.
Methyl (3aS,6aR)-5-benzyl-3,4,6,6a-tetrahydro-2H-furo[2,3-c]pyrrole-3a-carboxylate (CAS 2696257-39-1) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: methyl (3aS,6aR)-5-benzyl-3,4,6,6a-tetrahydro-2H-furo[2,3-c]pyrrole-3a-carboxylate. InChIKey: PRBRMGFBZIXOSR-ZFWWWQNUSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | methyl (3aS,6aR)-5-benzyl-3,4,6,6a-tetrahydro-2H-furo[2,3-c]pyrrole-3a-carboxylate |
| InChIKey | PRBRMGFBZIXOSR-ZFWWWQNUSA-N |
| SMILES | COC(=O)[C@]12CCO[C@H]1CN(C2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)