CAS 2696257-96-0 is the registry number for Rel-((3aR,6aS)-6a-fluorohexahydrocyclopenta[c]pyrrol-3a(1H)-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3aR,6aS)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6a-yl]methanol (CAS 2696257-96-0) is a chemical compound with the molecular formula C8H14FNO and a molecular weight of 159.20 g/mol. IUPAC name: [(3aR,6aS)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6a-yl]methanol. InChIKey: WMERYXABTIZQTD-YUMQZZPRSA-N.
| Molecular formula | C8H14FNO |
|---|---|
| Molecular weight | 159.20 g/mol |
| IUPAC name | [(3aR,6aS)-3a-fluoro-1,2,3,4,5,6-hexahydrocyclopenta[c]pyrrol-6a-yl]methanol |
| InChIKey | WMERYXABTIZQTD-YUMQZZPRSA-N |
| SMILES | C1C[C@]2(CNC[C@]2(C1)F)CO |
Computed by PubChem (NCBI)