Products 2850336-33-1
CAS 2850336-33-1 is the registry number for ((2S,4R)-1-Cyclopropyl-4-fluoropyrrolidin-2-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2S,4R)-1-cyclopropyl-4-fluoropyrrolidin-2-yl]methanol (CAS 2850336-33-1) is a chemical compound with the molecular formula C8H14FNO and a molecular weight of 159.20 g/mol. IUPAC name: [(2S,4R)-1-cyclopropyl-4-fluoropyrrolidin-2-yl]methanol. InChIKey: RMAKWVOMIUUKOB-SVRRBLITSA-N.
| Molecular formula | C8H14FNO |
|---|---|
| Molecular weight | 159.20 g/mol |
| IUPAC name | [(2S,4R)-1-cyclopropyl-4-fluoropyrrolidin-2-yl]methanol |
| InChIKey | RMAKWVOMIUUKOB-SVRRBLITSA-N |
| SMILES | C1CC1N2C[C@@H](C[C@H]2CO)F |
Computed by PubChem (NCBI)