Products 2883770-63-4
CAS 2883770-63-4 is the registry number for ((2S,7aR)-2-Fluorotetrahydro-1H-pyrrolizin-7a(5H)-yl)methanol-d2, 98.54%. Offered by: MedChemExpress. Available pack sizes: 250 mg, 50 mg, 100 mg, 500 mg.
Dideuterio-[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (CAS 2883770-63-4) is a chemical compound with the molecular formula C8H14FNO and a molecular weight of 161.21 g/mol. IUPAC name: dideuterio-[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol. InChIKey: QAJRFPVPHUYVFE-BUFGFUPTSA-N.
| Molecular formula | C8H14FNO |
|---|---|
| Molecular weight | 161.21 g/mol |
| IUPAC name | dideuterio-[(2S,8R)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| InChIKey | QAJRFPVPHUYVFE-BUFGFUPTSA-N |
| SMILES | [2H]C([2H])([C@]12CCCN1C[C@H](C2)F)O |
Computed by PubChem (NCBI)