Products 269731-55-7

CAS 269731-55-7 is the registry number for 4-Bromo-2-propoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

4-bromo-2-propoxybenzoic acid (CAS 269731-55-7) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 4-bromo-2-propoxybenzoic acid. InChIKey: RDOBBDKYPTZFCM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11BrO3
Molecular weight259.10 g/mol
IUPAC name4-bromo-2-propoxybenzoic acid
InChIKeyRDOBBDKYPTZFCM-UHFFFAOYSA-N
SMILESCCCOC1=C(C=CC(=C1)Br)C(=O)O

Computed by PubChem (NCBI)