CAS 269731-55-7 is the registry number for 4-Bromo-2-propoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
4-bromo-2-propoxybenzoic acid (CAS 269731-55-7) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: 4-bromo-2-propoxybenzoic acid. InChIKey: RDOBBDKYPTZFCM-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | 4-bromo-2-propoxybenzoic acid |
| InChIKey | RDOBBDKYPTZFCM-UHFFFAOYSA-N |
| SMILES | CCCOC1=C(C=CC(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)