Products 2699702-10-6
CAS 2699702-10-6 is the registry number for 1-(tert-Butyl) 3-ethyl 4-phenyl-2,5-dihydro-1H-pyrrole-1,3-dicarboxylate, 95%. Offered by: BLDpharm. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
1-O-tert-butyl 3-O-ethyl 4-phenyl-2,5-dihydropyrrole-1,3-dicarboxylate (CAS 2699702-10-6) is a chemical compound with the molecular formula C18H23NO4 and a molecular weight of 317.4 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 4-phenyl-2,5-dihydropyrrole-1,3-dicarboxylate. InChIKey: PXHTUCLWFWZSTP-UHFFFAOYSA-N.
| Molecular formula | C18H23NO4 |
|---|---|
| Molecular weight | 317.4 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 4-phenyl-2,5-dihydropyrrole-1,3-dicarboxylate |
| InChIKey | PXHTUCLWFWZSTP-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(CN(C1)C(=O)OC(C)(C)C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)