CAS 2701595-23-3 is the registry number for N,4′-Diphenyl[1,1′:2′,1′′:4′′,1′′′-quaterphenyl]-4′′′-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
4-[4-(2,5-diphenylphenyl)phenyl]-N-phenylaniline (CAS 2701595-23-3) is a chemical compound with the molecular formula C36H27N and a molecular weight of 473.6 g/mol. IUPAC name: 4-[4-(2,5-diphenylphenyl)phenyl]-N-phenylaniline. InChIKey: JWOZBDIFEHRWAU-UHFFFAOYSA-N.
| Molecular formula | C36H27N |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | 4-[4-(2,5-diphenylphenyl)phenyl]-N-phenylaniline |
| InChIKey | JWOZBDIFEHRWAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C=C2)C3=CC=CC=C3)C4=CC=C(C=C4)C5=CC=C(C=C5)NC6=CC=CC=C6 |
Computed by PubChem (NCBI)