Products 2701595-23-3

CAS 2701595-23-3 is the registry number for N,4′-Diphenyl[1,1′:2′,1′′:4′′,1′′′-quaterphenyl]-4′′′-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-[4-(2,5-diphenylphenyl)phenyl]-N-phenylaniline (CAS 2701595-23-3) is a chemical compound with the molecular formula C36H27N and a molecular weight of 473.6 g/mol. IUPAC name: 4-[4-(2,5-diphenylphenyl)phenyl]-N-phenylaniline. InChIKey: JWOZBDIFEHRWAU-UHFFFAOYSA-N.

Identity
Molecular formulaC36H27N
Molecular weight473.6 g/mol
IUPAC name4-[4-(2,5-diphenylphenyl)phenyl]-N-phenylaniline
InChIKeyJWOZBDIFEHRWAU-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC(=C(C=C2)C3=CC=CC=C3)C4=CC=C(C=C4)C5=CC=C(C=C5)NC6=CC=CC=C6

Computed by PubChem (NCBI)