CAS 897671-71-5 appears in our catalog under these names: Di((1,1':3',1''–terphenyl)–4–yl)amine, Di([1,1':3',1''-terphenyl]-4-yl)amine, >95.0%(HPLC)(T), Di([1,1':3',1''-terphenyl]-4-yl)amine, 95%, 95%. Offered by: GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg.
4-(3-phenylphenyl)-N-[4-(3-phenylphenyl)phenyl]aniline (CAS 897671-71-5) is a chemical compound with the molecular formula C36H27N and a molecular weight of 473.6 g/mol. IUPAC name: 4-(3-phenylphenyl)-N-[4-(3-phenylphenyl)phenyl]aniline. InChIKey: URFIVZPTKJSHIP-UHFFFAOYSA-N.
| Molecular formula | C36H27N |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | 4-(3-phenylphenyl)-N-[4-(3-phenylphenyl)phenyl]aniline |
| InChIKey | URFIVZPTKJSHIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=CC=C(C=C3)NC4=CC=C(C=C4)C5=CC=CC(=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)