CAS 6543-20-0 appears in our catalog under these names: Tris(4-biphenylyl)amine, 95%, Tri(biphenyl-4-yl)amine, Sublimed >99%, Poly(2,5-bisoctyloxy)-1,4-phenylenevinylene), Tris(4–biphenylyl)amine, Tris(4-biphenylyl)amine (purified by sublimation), >98.0%(HPLC)(N). Offered by: Combi-blocks, Lumtec, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 1g, On request, 250mg, 200mg, 100mg.
4-phenyl-N,N-bis(4-phenylphenyl)aniline (CAS 6543-20-0) is a chemical compound with the molecular formula C36H27N and a molecular weight of 473.6 g/mol. IUPAC name: 4-phenyl-N,N-bis(4-phenylphenyl)aniline. InChIKey: RORPOZIIMCFMFH-UHFFFAOYSA-N.
| Molecular formula | C36H27N |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | 4-phenyl-N,N-bis(4-phenylphenyl)aniline |
| InChIKey | RORPOZIIMCFMFH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N(C3=CC=C(C=C3)C4=CC=CC=C4)C5=CC=C(C=C5)C6=CC=CC=C6 |
Computed by PubChem (NCBI)