CAS 1222634-03-8 is the registry number for N-([1,1':4',1''-Terphenyl]-4-yl)-[1,1':2',1''-terphenyl]-4-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
4-(4-phenylphenyl)-N-[4-(2-phenylphenyl)phenyl]aniline (CAS 1222634-03-8) is a chemical compound with the molecular formula C36H27N and a molecular weight of 473.6 g/mol. IUPAC name: 4-(4-phenylphenyl)-N-[4-(2-phenylphenyl)phenyl]aniline. InChIKey: PROMDXRVIZLPSG-UHFFFAOYSA-N.
| Molecular formula | C36H27N |
|---|---|
| Molecular weight | 473.6 g/mol |
| IUPAC name | 4-(4-phenylphenyl)-N-[4-(2-phenylphenyl)phenyl]aniline |
| InChIKey | PROMDXRVIZLPSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=CC=C(C=C3)NC4=CC=C(C=C4)C5=CC=CC=C5C6=CC=CC=C6 |
Computed by PubChem (NCBI)