CAS 27018-21-9 appears in our catalog under these names: 5-Methoxy-quinazoline-2,4-diamine, 5–Methoxyquinazoline–2,4–diamine, 5-Methoxyquinazoline-2,4-diamine 95%, 5-Methoxyquinazoline-2,4-diamine, 95%, 95%, 5-Methoxyquinazoline-2,4-diamine, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 500mg, 250mg, 1g, 5g, 100mg.
5-methoxyquinazoline-2,4-diamine (CAS 27018-21-9) is a chemical compound with the molecular formula C9H10N4O and a molecular weight of 190.20 g/mol. IUPAC name: 5-methoxyquinazoline-2,4-diamine. InChIKey: FYEWYRWGCVGNJW-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 5-methoxyquinazoline-2,4-diamine |
| InChIKey | FYEWYRWGCVGNJW-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=NC(=N2)N)N |
Computed by PubChem (NCBI)