Products 27018-75-3

CAS 27018-75-3 is the registry number for Carbobenzoxy-D,L-tryptophanamide. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.

Structural formula: {0} (CAS {1})

Benzyl N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate (CAS 27018-75-3) is a chemical compound with the molecular formula C19H19N3O3 and a molecular weight of 337.4 g/mol. IUPAC name: benzyl N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate. InChIKey: GGRKLCWXRBTPLH-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19N3O3
Molecular weight337.4 g/mol
IUPAC namebenzyl N-[1-amino-3-(1H-indol-3-yl)-1-oxopropan-2-yl]carbamate
InChIKeyGGRKLCWXRBTPLH-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)N

Computed by PubChem (NCBI)