Products 2703646-17-5
CAS 2703646-17-5 is the registry number for N–Methylethylone (hydrochloride). Offered by: GLPBio. Available pack sizes: 5mg, 1mg.
1-(1,3-benzodioxol-5-yl)-2-[ethyl(methyl)amino]propan-1-one;hydrochloride (CAS 2703646-17-5) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-[ethyl(methyl)amino]propan-1-one;hydrochloride. InChIKey: YTQNIFDOIXPJTG-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-[ethyl(methyl)amino]propan-1-one;hydrochloride |
| InChIKey | YTQNIFDOIXPJTG-UHFFFAOYSA-N |
| SMILES | CCN(C)C(C)C(=O)C1=CC2=C(C=C1)OCO2.Cl |
Computed by PubChem (NCBI)