Products 2703696-89-1
CAS 2703696-89-1 is the registry number for 2-benzyl-6-chloro-3,4-dihydro-1H-isoquinolin-4-ol, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
2-benzyl-6-chloro-3,4-dihydro-1H-isoquinolin-4-ol (CAS 2703696-89-1) is a chemical compound with the molecular formula C16H16ClNO and a molecular weight of 273.75 g/mol. IUPAC name: 2-benzyl-6-chloro-3,4-dihydro-1H-isoquinolin-4-ol. InChIKey: PGCUIZMPAABURQ-UHFFFAOYSA-N.
| Molecular formula | C16H16ClNO |
|---|---|
| Molecular weight | 273.75 g/mol |
| IUPAC name | 2-benzyl-6-chloro-3,4-dihydro-1H-isoquinolin-4-ol |
| InChIKey | PGCUIZMPAABURQ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(CN1CC3=CC=CC=C3)C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)