CAS 2703696-90-4 is the registry number for tert-butyl cis-3-(2,6-dichloropyridine-4-carbonyl)cyclobutanecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 3-(2,6-dichloropyridine-4-carbonyl)cyclobutane-1-carboxylate (CAS 2703696-90-4) is a chemical compound with the molecular formula C15H17Cl2NO3 and a molecular weight of 330.2 g/mol. IUPAC name: tert-butyl 3-(2,6-dichloropyridine-4-carbonyl)cyclobutane-1-carboxylate. InChIKey: ZOTFBJQMJJQZMX-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO3 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | tert-butyl 3-(2,6-dichloropyridine-4-carbonyl)cyclobutane-1-carboxylate |
| InChIKey | ZOTFBJQMJJQZMX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(C1)C(=O)C2=CC(=NC(=C2)Cl)Cl |
Computed by PubChem (NCBI)