CAS 912763-77-0 is the registry number for 1-(2,6-Dichlorobenzamido)cycloheptanecarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(2,6-dichlorobenzoyl)amino]cycloheptane-1-carboxylic acid (CAS 912763-77-0) is a chemical compound with the molecular formula C15H17Cl2NO3 and a molecular weight of 330.2 g/mol. IUPAC name: 1-[(2,6-dichlorobenzoyl)amino]cycloheptane-1-carboxylic acid. InChIKey: LPYNZXRPDCUDHN-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO3 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 1-[(2,6-dichlorobenzoyl)amino]cycloheptane-1-carboxylic acid |
| InChIKey | LPYNZXRPDCUDHN-UHFFFAOYSA-N |
| SMILES | C1CCCC(CC1)(C(=O)O)NC(=O)C2=C(C=CC=C2Cl)Cl |
Computed by PubChem (NCBI)