CAS 447421-04-7 is the registry number for 4-Butoxy-6,7-dichloro-3-(hydroxymethyl)-2-methylisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-butoxy-6,7-dichloro-3-(hydroxymethyl)-2-methylisoquinolin-1-one (CAS 447421-04-7) is a chemical compound with the molecular formula C15H17Cl2NO3 and a molecular weight of 330.2 g/mol. IUPAC name: 4-butoxy-6,7-dichloro-3-(hydroxymethyl)-2-methylisoquinolin-1-one. InChIKey: DWMGXTNGQFKFOP-UHFFFAOYSA-N.
| Molecular formula | C15H17Cl2NO3 |
|---|---|
| Molecular weight | 330.2 g/mol |
| IUPAC name | 4-butoxy-6,7-dichloro-3-(hydroxymethyl)-2-methylisoquinolin-1-one |
| InChIKey | DWMGXTNGQFKFOP-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(N(C(=O)C2=CC(=C(C=C21)Cl)Cl)C)CO |
Computed by PubChem (NCBI)