CAS 2703756-63-0 is the registry number for 2-Chloro-5-(2-ethoxy-2-oxoethoxy)pyridine 1-oxide, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 2-(6-chloro-1-oxidopyridin-1-ium-3-yl)oxyacetate (CAS 2703756-63-0) is a chemical compound with the molecular formula C9H10ClNO4 and a molecular weight of 231.63 g/mol. IUPAC name: ethyl 2-(6-chloro-1-oxidopyridin-1-ium-3-yl)oxyacetate. InChIKey: YPHPEYXQYHPCMQ-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO4 |
|---|---|
| Molecular weight | 231.63 g/mol |
| IUPAC name | ethyl 2-(6-chloro-1-oxidopyridin-1-ium-3-yl)oxyacetate |
| InChIKey | YPHPEYXQYHPCMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=C[N+](=C(C=C1)Cl)[O-] |
Computed by PubChem (NCBI)