Products 2703972-65-8
CAS 2703972-65-8 is the registry number for RCS–4 N–(5–hydroxypentyl) metabolite–d5. Offered by: GLPBio. Available pack sizes: 1mg, 100μg, 500μg.
(4-methoxyphenyl)-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone (CAS 2703972-65-8) is a chemical compound with the molecular formula C21H23NO3 and a molecular weight of 342.4 g/mol. IUPAC name: (4-methoxyphenyl)-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone. InChIKey: NIQWYBPFQLBKGZ-YNVVSFNJSA-N.
| Molecular formula | C21H23NO3 |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | (4-methoxyphenyl)-[2,4,5,6,7-pentadeuterio-1-(5-hydroxypentyl)indol-3-yl]methanone |
| InChIKey | NIQWYBPFQLBKGZ-YNVVSFNJSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(N2CCCCCO)[2H])C(=O)C3=CC=C(C=C3)OC)[2H])[2H] |
Computed by PubChem (NCBI)