CAS 2708280-58-2 appears in our catalog under these names: 2-(2-Ethoxyphenoxy)acetic acid-d5, (2-Ethoxy-d5-phenoxy)acetic Acid, 99 atom % D, min 98% Chemical Purity. Offered by: MedChemExpress, CDN. Available pack sizes: 1 mg, 0,25g, 0,1g.
2-[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]acetic acid (CAS 2708280-58-2) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 201.23 g/mol. IUPAC name: 2-[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]acetic acid. InChIKey: MZQTVOLNWAPPBT-ZBJDZAJPSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 201.23 g/mol |
| IUPAC name | 2-[2-(1,1,2,2,2-pentadeuterioethoxy)phenoxy]acetic acid |
| InChIKey | MZQTVOLNWAPPBT-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])OC1=CC=CC=C1OCC(=O)O |
Computed by PubChem (NCBI)