Products 2708281-97-2
CAS 2708281-97-2 is the registry number for tert-butyl 4-bromo-3,3-dimethyl-2-oxo-indoline-6-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 4-bromo-3,3-dimethyl-2-oxo-1H-indole-6-carboxylate (CAS 2708281-97-2) is a chemical compound with the molecular formula C15H18BrNO3 and a molecular weight of 340.21 g/mol. IUPAC name: tert-butyl 4-bromo-3,3-dimethyl-2-oxo-1H-indole-6-carboxylate. InChIKey: UQAFDGASIZHWLH-UHFFFAOYSA-N.
| Molecular formula | C15H18BrNO3 |
|---|---|
| Molecular weight | 340.21 g/mol |
| IUPAC name | tert-butyl 4-bromo-3,3-dimethyl-2-oxo-1H-indole-6-carboxylate |
| InChIKey | UQAFDGASIZHWLH-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2Br)C(=O)OC(C)(C)C)NC1=O)C |
Computed by PubChem (NCBI)