Products 2708292-32-2
CAS 2708292-32-2 is the registry number for 1-(5-nitro-2-tetrahydropyran-2-yl-pyrazol-3-yl)ethanone, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-[3-nitro-1-(oxan-2-yl)pyrazol-5-yl]ethanone (CAS 2708292-32-2) is a chemical compound with the molecular formula C10H13N3O4 and a molecular weight of 239.23 g/mol. IUPAC name: 1-[3-nitro-1-(oxan-2-yl)pyrazol-5-yl]ethanone. InChIKey: JGPSJLLXHGOCIO-UHFFFAOYSA-N.
| Molecular formula | C10H13N3O4 |
|---|---|
| Molecular weight | 239.23 g/mol |
| IUPAC name | 1-[3-nitro-1-(oxan-2-yl)pyrazol-5-yl]ethanone |
| InChIKey | JGPSJLLXHGOCIO-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=NN1C2CCCCO2)[N+](=O)[O-] |
Computed by PubChem (NCBI)