CAS 2714339-90-7 appears in our catalog under these names: L-Carnosine-d4 (N-beta-alanyl-d4), 98 atom % D, min 98% Chemical Purity, L-Carnosine-d4 (N-Beta-alanyl-d4), >95% (HPLC), L–Carnosine–d4, L-Carnosine-d4, 99.00%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,005g, 5mg, 1mg, 500μg, 1 mg.
(2S)-2-[(3-amino-2,2,3,3-tetradeuteriopropanoyl)amino]-3-(1H-imidazol-5-yl)propanoic acid (CAS 2714339-90-7) is a chemical compound with the molecular formula C9H14N4O3 and a molecular weight of 230.26 g/mol. IUPAC name: (2S)-2-[(3-amino-2,2,3,3-tetradeuteriopropanoyl)amino]-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: CQOVPNPJLQNMDC-IMRHFWKNSA-N.
| Molecular formula | C9H14N4O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | (2S)-2-[(3-amino-2,2,3,3-tetradeuteriopropanoyl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | CQOVPNPJLQNMDC-IMRHFWKNSA-N |
| SMILES | [2H]C([2H])(C(=O)N[C@@H](CC1=CN=CN1)C(=O)O)C([2H])([2H])N |
Computed by PubChem (NCBI)