CAS 6497-78-5 appears in our catalog under these names: Rgw 611, 95%, RGW 611/ 98%, RGW 611, RGW-611 99%, RGW-611, 98.78%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, MedChemExpress. Available pack sizes: 1g, 250mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
4-[2-(4-nitroimidazol-1-yl)ethyl]morpholine (CAS 6497-78-5) is a chemical compound with the molecular formula C9H14N4O3 and a molecular weight of 226.23 g/mol. IUPAC name: 4-[2-(4-nitroimidazol-1-yl)ethyl]morpholine. InChIKey: VDZAAIIQCHGJAD-UHFFFAOYSA-N.
| Molecular formula | C9H14N4O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 4-[2-(4-nitroimidazol-1-yl)ethyl]morpholine |
| InChIKey | VDZAAIIQCHGJAD-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCN2C=C(N=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)