CAS 5853-00-9 appears in our catalog under these names: Polaprezinc Impurity 9,D-carnosine, D-Carnosine, D-Carnosine trifluoroacetate. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 5g, 500mg, 2g, 250mg, 10g, 1000mg, 5000mg.
(2R)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid (CAS 5853-00-9) is a chemical compound with the molecular formula C9H14N4O3 and a molecular weight of 226.23 g/mol. IUPAC name: (2R)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid. InChIKey: CQOVPNPJLQNMDC-SSDOTTSWSA-N.
| Molecular formula | C9H14N4O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | (2R)-2-(3-aminopropanoylamino)-3-(1H-imidazol-5-yl)propanoic acid |
| InChIKey | CQOVPNPJLQNMDC-SSDOTTSWSA-N |
| SMILES | C1=C(NC=N1)C[C@H](C(=O)O)NC(=O)CCN |
Computed by PubChem (NCBI)