CAS 2714430-55-2 is the registry number for N-Acetyl-L-methionine-d3 (S-methyl-d3), 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g, 0,01g.
(2S)-2-acetamido-4-(trideuteriomethylsulfanyl)butanoic acid (CAS 2714430-55-2) is a chemical compound with the molecular formula C7H13NO3S and a molecular weight of 194.27 g/mol. IUPAC name: (2S)-2-acetamido-4-(trideuteriomethylsulfanyl)butanoic acid. InChIKey: XUYPXLNMDZIRQH-JFZJHJNYSA-N.
| Molecular formula | C7H13NO3S |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | (2S)-2-acetamido-4-(trideuteriomethylsulfanyl)butanoic acid |
| InChIKey | XUYPXLNMDZIRQH-JFZJHJNYSA-N |
| SMILES | [2H]C([2H])([2H])SCC[C@@H](C(=O)O)NC(=O)C |
Computed by PubChem (NCBI)