CAS 2714437-66-6 is the registry number for Phenmetetrazine-d5 Hydrochloride. Offered by: TRC. Available pack sizes: 25mg.
4-ethyl-3-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)morpholine;hydrochloride (CAS 2714437-66-6) is a chemical compound with the molecular formula C13H20ClNO and a molecular weight of 246.79 g/mol. IUPAC name: 4-ethyl-3-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)morpholine;hydrochloride. InChIKey: ACWLWKQMVIWDBR-REAAFBMTSA-N.
| Molecular formula | C13H20ClNO |
|---|---|
| Molecular weight | 246.79 g/mol |
| IUPAC name | 4-ethyl-3-methyl-2-(2,3,4,5,6-pentadeuteriophenyl)morpholine;hydrochloride |
| InChIKey | ACWLWKQMVIWDBR-REAAFBMTSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C2C(N(CCO2)CC)C)[2H])[2H].Cl |
Computed by PubChem (NCBI)