Products 2714843-39-5
CAS 2714843-39-5 is the registry number for Naproxen 2,3-Butylene Glycol Ester. Offered by: Mikromol. Available pack sizes: 25mg.
3-hydroxybutan-2-yl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (CAS 2714843-39-5) is a chemical compound with the molecular formula C18H22O4 and a molecular weight of 302.4 g/mol. IUPAC name: 3-hydroxybutan-2-yl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate. InChIKey: RJXMUSGIRIYDLJ-HIFPTAJRSA-N.
| Molecular formula | C18H22O4 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | 3-hydroxybutan-2-yl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| InChIKey | RJXMUSGIRIYDLJ-HIFPTAJRSA-N |
| SMILES | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)OC(C)C(C)O |
Computed by PubChem (NCBI)
Synonyms:
Naproxen 2,3-Butylene Glycol Ester