Products 2719063-12-2
CAS 2719063-12-2 is the registry number for Methyl 6-chloro-2-(dimethylamino)pyridine-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 6-chloro-2-(dimethylamino)pyridine-3-carboxylate (CAS 2719063-12-2) is a chemical compound with the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. IUPAC name: methyl 6-chloro-2-(dimethylamino)pyridine-3-carboxylate. InChIKey: KCIBFIABZSQNQK-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O2 |
|---|---|
| Molecular weight | 214.65 g/mol |
| IUPAC name | methyl 6-chloro-2-(dimethylamino)pyridine-3-carboxylate |
| InChIKey | KCIBFIABZSQNQK-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=CC(=N1)Cl)C(=O)OC |
Computed by PubChem (NCBI)