CAS 27210-58-8 is the registry number for N-(2,4-Dimethylphenyl)anthranilic Acid. Offered by: TRC. Available pack sizes: 5mg.
2-(2,4-dimethylanilino)benzoic acid (CAS 27210-58-8) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 2-(2,4-dimethylanilino)benzoic acid. InChIKey: VJVKYSGOJRLVPJ-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-(2,4-dimethylanilino)benzoic acid |
| InChIKey | VJVKYSGOJRLVPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=CC=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)