CAS 2725803-34-7 is the registry number for BDE 66-13C6. Offered by: TRC. Available pack sizes: 10mg.
1,2-dibromo-4-(2,4-dibromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxybenzene (CAS 2725803-34-7) is a chemical compound with the molecular formula C12H6Br4O and a molecular weight of 491.75 g/mol. IUPAC name: 1,2-dibromo-4-(2,4-dibromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxybenzene. InChIKey: DHUMTYRHKMCVAG-LMEUXNMNSA-N.
| Molecular formula | C12H6Br4O |
|---|---|
| Molecular weight | 491.75 g/mol |
| IUPAC name | 1,2-dibromo-4-(2,4-dibromo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxybenzene |
| InChIKey | DHUMTYRHKMCVAG-LMEUXNMNSA-N |
| SMILES | C1=CC(=C(C=C1O[13C]2=[13C]([13CH]=[13C]([13CH]=[13CH]2)Br)Br)Br)Br |
Computed by PubChem (NCBI)