CAS 93703-48-1 appears in our catalog under these names: PBDE 77, PBDE No. 77, BDE 77, 505G/ML IN NONANE, OEKANAL. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich. Available pack sizes: 100mg, 250mg, 25mg, 5mg, 1ML.
1,2-dibromo-4-(3,4-dibromophenoxy)benzene (CAS 93703-48-1) is a chemical compound with the molecular formula C12H6Br4O and a molecular weight of 485.79 g/mol. IUPAC name: 1,2-dibromo-4-(3,4-dibromophenoxy)benzene. InChIKey: RYGLOWMCGZHYRQ-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O |
|---|---|
| Molecular weight | 485.79 g/mol |
| IUPAC name | 1,2-dibromo-4-(3,4-dibromophenoxy)benzene |
| InChIKey | RYGLOWMCGZHYRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=CC(=C(C=C2)Br)Br)Br)Br |
Computed by PubChem (NCBI)