Products 189084-62-6

CAS 189084-62-6 is the registry number for 2,3',4',6-Tetrabromo-diphenyl ether. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1,2-dibromo-4-(2,6-dibromophenoxy)benzene (CAS 189084-62-6) is a chemical compound with the molecular formula C12H6Br4O and a molecular weight of 485.79 g/mol. IUPAC name: 1,2-dibromo-4-(2,6-dibromophenoxy)benzene. InChIKey: COPAGYRSCJVION-UHFFFAOYSA-N.

Identity
Molecular formulaC12H6Br4O
Molecular weight485.79 g/mol
IUPAC name1,2-dibromo-4-(2,6-dibromophenoxy)benzene
InChIKeyCOPAGYRSCJVION-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Br)OC2=CC(=C(C=C2)Br)Br)Br

Computed by PubChem (NCBI)