CAS 189084-62-6 is the registry number for 2,3',4',6-Tetrabromo-diphenyl ether. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1,2-dibromo-4-(2,6-dibromophenoxy)benzene (CAS 189084-62-6) is a chemical compound with the molecular formula C12H6Br4O and a molecular weight of 485.79 g/mol. IUPAC name: 1,2-dibromo-4-(2,6-dibromophenoxy)benzene. InChIKey: COPAGYRSCJVION-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O |
|---|---|
| Molecular weight | 485.79 g/mol |
| IUPAC name | 1,2-dibromo-4-(2,6-dibromophenoxy)benzene |
| InChIKey | COPAGYRSCJVION-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OC2=CC(=C(C=C2)Br)Br)Br |
Computed by PubChem (NCBI)