CAS 40088-47-9 appears in our catalog under these names: Tetrabromo-Diphenyl Ether , 1,2,3-Tribromo-4-(4-bromophenoxy)benzene. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1,2,3-tribromo-4-(3-bromophenoxy)benzene (CAS 40088-47-9) is a chemical compound with the molecular formula C12H6Br4O and a molecular weight of 485.79 g/mol. IUPAC name: 1,2,3-tribromo-4-(3-bromophenoxy)benzene. InChIKey: VIHUMJGEWQPWOT-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O |
|---|---|
| Molecular weight | 485.79 g/mol |
| IUPAC name | 1,2,3-tribromo-4-(3-bromophenoxy)benzene |
| InChIKey | VIHUMJGEWQPWOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OC2=C(C(=C(C=C2)Br)Br)Br |
Computed by PubChem (NCBI)