CAS 27278-76-8 is the registry number for rac-Ethyl (1R,2S)-2-benzylcyclopropane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Cis-ethyl (1R,2S)-2-benzylcyclopropane-1-carboxylate (CAS 27278-76-8) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: cis-ethyl (1R,2S)-2-benzylcyclopropane-1-carboxylate. InChIKey: KOACXUOASKUNMQ-VXGBXAGGSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-2-benzylcyclopropane-1-carboxylate |
| InChIKey | KOACXUOASKUNMQ-VXGBXAGGSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@H]1CC2=CC=CC=C2 |
Computed by PubChem (NCBI)