CAS 27285-18-3 is the registry number for N-(3,4-dimethylphenyl)benzamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
N-(3,4-dimethylphenyl)benzamide (CAS 27285-18-3) is a chemical compound with the molecular formula C15H15NO and a molecular weight of 225.28 g/mol. IUPAC name: N-(3,4-dimethylphenyl)benzamide. InChIKey: UCAIXIMMSIJHND-UHFFFAOYSA-N.
| Molecular formula | C15H15NO |
|---|---|
| Molecular weight | 225.28 g/mol |
| IUPAC name | N-(3,4-dimethylphenyl)benzamide |
| InChIKey | UCAIXIMMSIJHND-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=CC=C2)C |
Computed by PubChem (NCBI)