CAS 2731009-73-5 is the registry number for 1,3-DI-TERT-BUTYL 5-(HYDROXYMETHYL)-3-AZABICYCLO[3.1.1]HEPTANE-1,3-DICARBOXYLATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Ditert-butyl 5-(hydroxymethyl)-3-azabicyclo[3.1.1]heptane-1,3-dicarboxylate (CAS 2731009-73-5) is a chemical compound with the molecular formula C17H29NO5 and a molecular weight of 327.4 g/mol. IUPAC name: ditert-butyl 5-(hydroxymethyl)-3-azabicyclo[3.1.1]heptane-1,3-dicarboxylate. InChIKey: VQKRUGGWIZTXKG-UHFFFAOYSA-N.
| Molecular formula | C17H29NO5 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | ditert-butyl 5-(hydroxymethyl)-3-azabicyclo[3.1.1]heptane-1,3-dicarboxylate |
| InChIKey | VQKRUGGWIZTXKG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C12CC(C1)(CN(C2)C(=O)OC(C)(C)C)CO |
Computed by PubChem (NCBI)