Products 31948-48-8
CAS 31948-48-8 is the registry number for Cornucervine. Offered by: Biosynth. Available pack sizes: 25mg, 10mg, 50mg.
4-O-[[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl] 1-O-methyl (2S)-2-hydroxy-2-(2-methylpropyl)butanedioate (CAS 31948-48-8) is a chemical compound with the molecular formula C17H29NO5 and a molecular weight of 327.4 g/mol. IUPAC name: 4-O-[[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl] 1-O-methyl (2S)-2-hydroxy-2-(2-methylpropyl)butanedioate. InChIKey: NKZJCHCKRDGVKG-ZQIUZPCESA-N.
| Molecular formula | C17H29NO5 |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 4-O-[[(1R,8S)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]methyl] 1-O-methyl (2S)-2-hydroxy-2-(2-methylpropyl)butanedioate |
| InChIKey | NKZJCHCKRDGVKG-ZQIUZPCESA-N |
| SMILES | CC(C)C[C@](CC(=O)OC[C@@H]1CCN2[C@H]1CCC2)(C(=O)OC)O |
Computed by PubChem (NCBI)
Synonyms:
Cornucervine, orb1991671