Products 2920426-80-6

CAS 2920426-80-6 is the registry number for mPEG4-CH2CHO, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3-O-tert-butyl 9-O-methyl 9-hydroxy-3-azaspiro[5.5]undecane-3,9-dicarboxylate (CAS 2920426-80-6) is a chemical compound with the molecular formula C17H29NO5 and a molecular weight of 327.4 g/mol. IUPAC name: 3-O-tert-butyl 9-O-methyl 9-hydroxy-3-azaspiro[5.5]undecane-3,9-dicarboxylate. InChIKey: DPQGMJTWTRXYGN-UHFFFAOYSA-N.

Identity
Molecular formulaC17H29NO5
Molecular weight327.4 g/mol
IUPAC name3-O-tert-butyl 9-O-methyl 9-hydroxy-3-azaspiro[5.5]undecane-3,9-dicarboxylate
InChIKeyDPQGMJTWTRXYGN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCC(CC2)(C(=O)OC)O)CC1

Computed by PubChem (NCBI)