CAS 2731671-59-1 is the registry number for N-(2-Pyridinyl)oxamic Acid Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
2-oxo-2-(pyridin-2-ylamino)acetic acid;hydrochloride (CAS 2731671-59-1) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: 2-oxo-2-(pyridin-2-ylamino)acetic acid;hydrochloride. InChIKey: PRVSIJBHMPRUMB-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | 2-oxo-2-(pyridin-2-ylamino)acetic acid;hydrochloride |
| InChIKey | PRVSIJBHMPRUMB-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC(=O)C(=O)O.Cl |
Computed by PubChem (NCBI)