Products 2731997-93-4

CAS 2731997-93-4 is the registry number for 2-Ethylhexyl 2-(3-Benzoylphenyl)propionate (Ketoprofen 2-Ethylhexyl Ester). Offered by: Mikromol. Available pack sizes: 100mg.

Structural formula: {0} (CAS {1})

2-ethylhexyl 2-(3-benzoylphenyl)propanoate (CAS 2731997-93-4) is a chemical compound with the molecular formula C24H30O3 and a molecular weight of 366.5 g/mol. IUPAC name: 2-ethylhexyl 2-(3-benzoylphenyl)propanoate. InChIKey: TZIZAVMQKWLAIE-UHFFFAOYSA-N.

Identity
Molecular formulaC24H30O3
Molecular weight366.5 g/mol
IUPAC name2-ethylhexyl 2-(3-benzoylphenyl)propanoate
InChIKeyTZIZAVMQKWLAIE-UHFFFAOYSA-N
SMILESCCCCC(CC)COC(=O)C(C)C1=CC(=CC=C1)C(=O)C2=CC=CC=C2

Computed by PubChem (NCBI)