CAS 273222-03-0 appears in our catalog under these names: (S)-2-tert-Butoxycarbonylamino-4-pyridin-4-yl-butyric acid, 95%, (S)-2-((tert-Butoxycarbonyl)amino)-4-(pyridin-4-yl)butanoic acid, 95% HPLC(contains ~5.0% solvent), 95% HPLC(contains ~5.0% solvent), (S)-2-((TERT-BUTOXYCARBONYL)AMINO)-4-(PYRIDIN-4-YL)BUTANOIC ACID, 95%, Boc-4-Pal-HoAla-OH, 95% HPLC(contains ~5.0% solvent). Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg.
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-4-ylbutanoic acid (CAS 273222-03-0) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-4-ylbutanoic acid. InChIKey: RIORKFAJVAWLSJ-NSHDSACASA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-pyridin-4-ylbutanoic acid |
| InChIKey | RIORKFAJVAWLSJ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC1=CC=NC=C1)C(=O)O |
Computed by PubChem (NCBI)